Grade 10 → Carbon and its compounds ↓
Nomenclature of organic compounds (IUPAC system)
The International Union of Pure and Applied Chemistry (IUPAC) system is a method of naming organic chemical compounds. The purpose of this system is to give each compound a unique name based on its structure, making communication about chemicals more simple and standardized around the world. Let's explore the fundamental rules and steps involved in naming organic compounds using the IUPAC system.
Basics of organic compounds
Organic compounds are composed primarily of carbon and hydrogen atoms. They may also contain other elements such as oxygen, nitrogen, sulfur, and halogens (fluorine, chlorine, bromine, iodine). The simplest organic compounds are hydrocarbons, which are composed only of carbon and hydrogen. Hydrocarbons are divided into different categories such as alkanes, alkenes, and alkynes, depending on the type of bonds between the carbon atoms.
Hydrocarbons
Hydrocarbons form the basis of organic molecules and can be classified as follows:
- Alkanes: These are saturated hydrocarbons containing single covalent bonds (
CC
). Their general formula isCnH2n+2
. Examples include methane (CH4
), ethane (C2H6
), etc. - Alkene: Unsaturated hydrocarbon containing one or more double bonds (
C=C
). The general formula isCnH2n
. Examples are ethene (C2H4
), propene (C3H6
). - Alkynes: Unsaturated hydrocarbons containing one or more triple bonds (
C≡C
). The general formula isCnH2n-2
. Examples include acetylene (C2H2
).
IUPAC nomenclature rules
The IUPAC system uses a series of rules to name organic compounds systematically. The rules are as follows:
1. Identify the longest carbon chain
The first step in naming is to identify the longest continuous chain of carbon atoms in the molecule. This chain is used as the base name or parent hydrocarbon of the compound. If there is more than one chain of the same length, the chain with the most substituents is selected.
For example, in the above compound, the longest chain has 5 carbon atoms.
2. Number the carbon atoms in the chain
Once the longest chain is identified, the next step is to number the carbon atoms. The numbering should be done in such a way that the substituents get the lowest possible numbers.
1 2 3 4 5
|--|--|--|--|--
CH3-CH2-CH2-CH2-CH3
3. Identify substitutions
Substituents are groups of atoms protruding from the main carbon chain. Common substituents include methyl (-CH3
), ethyl (-C2H5
), chloro (-Cl
), and bromo (-Br
).
Example of a substituent:
- Methyl:
-CH3
- Ethyl:
-C2H5
4. Write down the names of the substituents and their position
Name each substituent with its corresponding position number on the carbon chain. If there is more than one substituent of the same type, use prefixes such as di-, tri-, etc. to indicate their number. They should be listed alphabetically regardless of their position numbers. Prefixes such as di-, tri- are not considered part of the substituent name in alphabetical order.
1 2 3 4 5
|--|--|--|--|--
CH3-CH(CH3)-CH-CH2-CH3
|
CH3
In the above example, the name would be 2,3-dimethylpentane.
5. Collect full names
Finally, combine all parts of the name: use the position number, the substituent name, and the name of the longest carbon chain. The full name should not contain any spaces. If there are multiple side chains, arrange them alphabetically with number-revealing numerical prefixes first.
For example:
1 2 3 4 5
|--|--|--|--|--
CH3-CH(CH3)-CH-CH2-CH(CH3)CH3
| |
CH3 CH3
It will be named 2,4,4-trimethylpentane.
Additional naming considerations
Naming rules for functional groups
Functional groups are specific groups of atoms within molecules that have characteristic chemical behavior. In IUPAC nomenclature, the presence of functional groups affects the naming and often compounds are classified as alcohols, ethers, amines, aldehydes, ketones, carboxylic acids, etc.
Alcohol
Alcohols contain -OH
functional group. The suffix "-ol" is used in their names. The position of the hydroxyl group is given by the lowest possible number on the carbon chain.
1 2 3
|--|--|--
CH3-CH2-OH
Propanol
Alkenes and alkynes
For compounds with one or more double or triple bonds, the suffix "-ene" or "-yne" is used to indicate the type of bond. The location of the multiple bond is indicated by a number before the suffix.
1 2 3 4
|--|--|--|--
CH3-CH=CH-CH3
But-2-ene
For a compound containing a triple bond:
1 2 3 4
|--|--|--|--
CH≡C-CH2-CH3
But-1-yne
Aldehyde and ketone
Aldehydes contain -CHO
group and the suffix "-al" is used. Ketones contain the carbonyl group -C=O
within the carbon chain and the suffix "-one" is used.
1 2 3
|--|--|--
CH3-CH2-CHO
Propanal
1 2 3
|--|--|--
CH3-CO-CH3
Propan-2-one
Carboxylic acid
Carboxylic acids contain -COOH
functional group and the suffix "-oic acid" is used.
1 2 3
|--|--|--
CH3-CH2-COOH
Propanoic acid
Complex compounds and special cases
For more complex compounds with multiple functional groups or multiple types of bonds, the priority of the functional groups determines the base name and suffix. Each functional group is given priority according to IUPAC rules to decide which suffix will be used for the main functional group, while others may be considered as substituents.
General hierarchy of functional groups
Different functional groups have different levels of priority. Generally, carboxylic acids have the highest priority, followed by other groups such as esters, amides, nitriles, aldehydes, ketones, alcohols, etc. Higher priority groups determine the end of the main chain, while lower priority groups are named as substituents using prefixes or as side chains with suffixes for alkyl groups, etc.
Example
1 2 3 4
|--|--|--|--
CH3-CH(COOH)-CH(OH)-CH3
The name of this compound would be: 3-hydroxybutanoic acid.
Molecules with rings
For compounds that contain a ring structure, such as cycloalkanes or aromatic hydrocarbons, the prefix "cyclo" is added to the name if the main carbon structure is cyclic.
C1 C2
/
C6 C3
| |
C5 C4
This cyclohexane is a basic ring structure representing a six-carbon ring without any substituents.
Conclusion
IUPAC nomenclature includes a wide range of rules and guidelines to name organic compounds effectively. By understanding the fundamental ideas of chain selection, functional group importance, and naming rules, one can understand even complex molecules. As students, it is important to practice these concepts using various examples to become proficient in the IUPAC system of naming organic compounds.